C22H22N2O4 — CID 118713172
2,5-bis[(4-methoxyphenyl)methylamino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 118713172) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2,5-bis[(4-methoxyphenyl)methylamino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[(4-methoxyphenyl)methylamino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 118713172 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2,5-bis[(4-methoxyphenyl)methylamino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COc1ccc(CNC2=CC(=O)C(NCc3ccc(OC)cc3)=CC2=O)cc1 |
| InChI | InChI=1S/C22H22N2O4/c1-27-17-7-3-15(4-8-17)13-23-19-11-22(26)20(12-21(19)25)24-14-16-5-9-18(28-2)10-6-16/h3-12,23-24H,13-14H2,1-2H3 |
| InChIKey | KELGDKHLQHCRFA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|