C38H30N4OS3 — CID 118713192
(E)-3-[5-[7-tert-butyl-10-[4-(N-phenylanilino)phenyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]-2-cyanoprop-2-enamide (PubChem CID 118713192) has the molecular formula C38H30N4OS3 and a molecular weight of 654.89 g/mol. Its IUPAC name is (E)-3-[5-[7-tert-butyl-10-[4-(N-phenylanilino)phenyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[5-[7-tert-butyl-10-[4-(N-phenylanilino)phenyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 118713192 |
| Molecular Formula | C38H30N4OS3 |
| Molecular Weight | 654.89 g/mol |
| Exact Mass | 654.16 |
| IUPAC Name | (E)-3-[5-[7-tert-butyl-10-[4-(N-phenylanilino)phenyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]-2-cyanoprop-2-enamide |
| SMILES | CC(C)(C)n1c2cc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)sc2c2sc(-c3ccc(/C=C(\C#N)C(N)=O)s3)cc21 |
| InChI | InChI=1S/C38H30N4OS3/c1-38(2,3)42-30-21-33(24-14-16-28(17-15-24)41(26-10-6-4-7-11-26)27-12-8-5-9-13-27)45-35(30)36-31(42)22-34(46-36)32-19-18-29(44-32)20-25(23-39)37(40)43/h4-22H,1-3H3,(H2,40,43)/b25-20+ |
| InChIKey | SQSBEJKTSMJWRT-LKUDQCMESA-N |
| XLogP | 10.93 |
| TPSA | 75.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.89 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|