C19H20ClN7OS — CID 118713249
2-[[5-chloro-2-(5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepin-2-ylamino)pyrimidin-4-yl]amino]-N-methylbenzamide (PubChem CID 118713249) has the molecular formula C19H20ClN7OS and a molecular weight of 429.94 g/mol. Its IUPAC name is 2-[[5-chloro-2-(5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepin-2-ylamino)pyrimidin-4-yl]amino]-N-methylbenzamide.
| Compound Name | 2-[[5-chloro-2-(5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepin-2-ylamino)pyrimidin-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 118713249 |
| Molecular Formula | C19H20ClN7OS |
| Molecular Weight | 429.94 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2-[[5-chloro-2-(5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepin-2-ylamino)pyrimidin-4-yl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1Nc1nc(Nc2nc3c(s2)CCNCC3)ncc1Cl |
| InChI | InChI=1S/C19H20ClN7OS/c1-21-17(28)11-4-2-3-5-13(11)24-16-12(20)10-23-18(26-16)27-19-25-14-6-8-22-9-7-15(14)29-19/h2-5,10,22H,6-9H2,1H3,(H,21,28)(H2,23,24,25,26,27) |
| InChIKey | YKKMSYLSEXFJCA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.94 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |