About 2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate
2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate (PubChem CID 118713387) has the molecular formula C22H16Cl2N4O4
and a molecular weight of 471.30 g/mol. Its IUPAC name is 2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate.
Molecular Properties
| Compound Name | 2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate |
| PubChem CID | 118713387 |
| Molecular Formula | C22H16Cl2N4O4 |
| Molecular Weight | 471.30 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate |
| SMILES | O=C(OCCn1c([N+](=O)[O-])cnc1/C=C\c1ccc(Cl)cc1Cl)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H16Cl2N4O4/c23-15-7-5-14(18(24)11-15)6-8-20-26-13-21(28(30)31)27(20)9-10-32-22(29)17-12-25-19-4-2-1-3-16(17)19/h1-8,11-13,25H,9-10H2/b8-6- |
| InChIKey | BRSAETBHZWDCBZ-VURMDHGXSA-N |
| XLogP | 5.61 |
| TPSA | 103.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.30 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate?
The IUPAC name of 2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate (CID 118713387) is 2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate.
What is the SMILES notation for 2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate?
The canonical SMILES for 2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate is O=C(OCCn1c([N+](=O)[O-])cnc1/C=C\c1ccc(Cl)cc1Cl)c1c[nH]c2ccccc12.
What is the InChIKey of 2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate?
The InChIKey is BRSAETBHZWDCBZ-VURMDHGXSA-N. The full InChI is InChI=1S/C22H16Cl2N4O4/c23-15-7-5-14(18(24)11-15)6-8-20-26-13-21(28(30)31)27(20)9-10-32-22(29)17-12-25-19-4-2-1-3-16(17)19/h1-8,11-13,25H,9-10H2/b8-6-.
What are the key properties of 2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate?
2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate has a molecular weight of 471.30 g/mol, XLogP of 5.61, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(Z)-2-(2,4-dichlorophenyl)ethenyl]-5-nitroimidazol-1-yl]ethyl 1H-indole-3-carboxylate is sourced from PubChem (CID 118713387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).