About tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate
tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate (PubChem CID 118713497) has the molecular formula C25H35N3O5
and a molecular weight of 457.57 g/mol. Its IUPAC name is tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate |
| PubChem CID | 118713497 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate |
| SMILES | Cc1cn(C(=O)OC(C)(C)C)c(=O)n(Cc2ccc(OCCCN3CCCCC3)cc2)c1=O |
| InChI | InChI=1S/C25H35N3O5/c1-19-17-28(24(31)33-25(2,3)4)23(30)27(22(19)29)18-20-9-11-21(12-10-20)32-16-8-15-26-13-6-5-7-14-26/h9-12,17H,5-8,13-16,18H2,1-4H3 |
| InChIKey | PLPHKSRHAHHVJH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate?
The IUPAC name of tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate (CID 118713497) is tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate.
What is the SMILES notation for tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate?
The canonical SMILES for tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate is Cc1cn(C(=O)OC(C)(C)C)c(=O)n(Cc2ccc(OCCCN3CCCCC3)cc2)c1=O.
What is the InChIKey of tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate?
The InChIKey is PLPHKSRHAHHVJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35N3O5/c1-19-17-28(24(31)33-25(2,3)4)23(30)27(22(19)29)18-20-9-11-21(12-10-20)32-16-8-15-26-13-6-5-7-14-26/h9-12,17H,5-8,13-16,18H2,1-4H3.
What are the key properties of tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate?
tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate has a molecular weight of 457.57 g/mol, XLogP of 3.40, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-1-carboxylate is sourced from PubChem (CID 118713497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).