About 2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate
2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate (PubChem CID 118713542) has the molecular formula C12H24NO4PS2
and a molecular weight of 341.44 g/mol. Its IUPAC name is 2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate.
Molecular Properties
| Compound Name | 2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate |
| PubChem CID | 118713542 |
| Molecular Formula | C12H24NO4PS2 |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate |
| SMILES | CCCOP(=O)(O)OCCSC(=S)N1CCCCCC1 |
| InChI | InChI=1S/C12H24NO4PS2/c1-2-9-16-18(14,15)17-10-11-20-12(19)13-7-5-3-4-6-8-13/h2-11H2,1H3,(H,14,15) |
| InChIKey | RQSWWMFDZGEHEU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate?
The IUPAC name of 2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate (CID 118713542) is 2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate.
What is the SMILES notation for 2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate?
The canonical SMILES for 2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate is CCCOP(=O)(O)OCCSC(=S)N1CCCCCC1.
What is the InChIKey of 2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate?
The InChIKey is RQSWWMFDZGEHEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24NO4PS2/c1-2-9-16-18(14,15)17-10-11-20-12(19)13-7-5-3-4-6-8-13/h2-11H2,1H3,(H,14,15).
What are the key properties of 2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate?
2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate has a molecular weight of 341.44 g/mol, XLogP of 3.42, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[hydroxy(propoxy)phosphoryl]oxyethyl azepane-1-carbodithioate is sourced from PubChem (CID 118713542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).