C18H13N5O4S — CID 118713610
N-[(6-nitro-1,3-benzothiazol-2-yl)methyl]-2-(4-oxoquinazolin-3-yl)acetamide (PubChem CID 118713610) has the molecular formula C18H13N5O4S and a molecular weight of 395.40 g/mol. Its IUPAC name is N-[(6-nitro-1,3-benzothiazol-2-yl)methyl]-2-(4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[(6-nitro-1,3-benzothiazol-2-yl)methyl]-2-(4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 118713610 |
| Molecular Formula | C18H13N5O4S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N-[(6-nitro-1,3-benzothiazol-2-yl)methyl]-2-(4-oxoquinazolin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)NCc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C18H13N5O4S/c24-16(9-22-10-20-13-4-2-1-3-12(13)18(22)25)19-8-17-21-14-6-5-11(23(26)27)7-15(14)28-17/h1-7,10H,8-9H2,(H,19,24) |
| InChIKey | MKTPNAMLMBTDHQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|