C28H29NO2 — CID 118713652
(8S,9S,13S,14S)-17-isoquinolin-6-yl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 118713652) has the molecular formula C28H29NO2 and a molecular weight of 411.55 g/mol. Its IUPAC name is (8S,9S,13S,14S)-17-isoquinolin-6-yl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9S,13S,14S)-17-isoquinolin-6-yl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 118713652 |
| Molecular Formula | C28H29NO2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | (8S,9S,13S,14S)-17-isoquinolin-6-yl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | COc1cc2c(cc1O)CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3ccc4cnccc4c3)=CC[C@@H]12 |
| InChI | InChI=1S/C28H29NO2/c1-28-11-9-21-22(6-5-18-14-26(30)27(31-2)15-23(18)21)25(28)8-7-24(28)19-3-4-20-16-29-12-10-17(20)13-19/h3-4,7,10,12-16,21-22,25,30H,5-6,8-9,11H2,1-2H3/t21-,22+,25-,28+/m0/s1 |
| InChIKey | PICHZEGIXWASHK-DOCBIHDTSA-N |
| XLogP | 6.50 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |