C28H31NO2 — CID 118713658
(8S,9S,13S,14S,17S)-17-isoquinolin-5-yl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 118713658) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is (8S,9S,13S,14S,17S)-17-isoquinolin-5-yl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9S,13S,14S,17S)-17-isoquinolin-5-yl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 118713658 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | (8S,9S,13S,14S,17S)-17-isoquinolin-5-yl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | COc1cc2c(cc1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](c3cccc4cnccc34)CC[C@@H]12 |
| InChI | InChI=1S/C28H31NO2/c1-28-12-10-20-22(7-6-17-14-26(30)27(31-2)15-23(17)20)25(28)9-8-24(28)21-5-3-4-18-16-29-13-11-19(18)21/h3-5,11,13-16,20,22,24-25,30H,6-10,12H2,1-2H3/t20-,22+,24+,25-,28+/m0/s1 |
| InChIKey | NTVVOHVKYUDUMB-AGATZJSKSA-N |
| XLogP | 6.59 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |