C16H17N4O7P — CID 118713664
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-phenylpurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 118713664) has the molecular formula C16H17N4O7P and a molecular weight of 408.31 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-phenylpurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-phenylpurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 118713664 |
| Molecular Formula | C16H17N4O7P |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-phenylpurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1O[C@@H](n2cnc3c(-c4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H17N4O7P/c21-13-10(6-26-28(23,24)25)27-16(14(13)22)20-8-19-12-11(17-7-18-15(12)20)9-4-2-1-3-5-9/h1-5,7-8,10,13-14,16,21-22H,6H2,(H2,23,24,25)/t10-,13-,14-,16-/m1/s1 |
| InChIKey | LSNYQUUKDWGDSC-DSPGLSBSSA-N |
| XLogP | 0.22 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|