C20H22N5O10P — CID 118713669
4-[4-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]purin-6-yl]anilino]-4-oxobutanoic acid (PubChem CID 118713669) has the molecular formula C20H22N5O10P and a molecular weight of 523.40 g/mol. Its IUPAC name is 4-[4-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]purin-6-yl]anilino]-4-oxobutanoic acid.
| Compound Name | 4-[4-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]purin-6-yl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 118713669 |
| Molecular Formula | C20H22N5O10P |
| Molecular Weight | 523.40 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 4-[4-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]purin-6-yl]anilino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1ccc(-c2ncnc3c2ncn3[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C20H22N5O10P/c26-13(5-6-14(27)28)24-11-3-1-10(2-4-11)15-16-19(22-8-21-15)25(9-23-16)20-18(30)17(29)12(35-20)7-34-36(31,32)33/h1-4,8-9,12,17-18,20,29-30H,5-7H2,(H,24,26)(H,27,28)(H2,31,32,33)/t12-,17-,18-,20-/m1/s1 |
| InChIKey | BAJVBHHSOGSUFL-QBBVKUELSA-N |
| XLogP | 0.03 |
| TPSA | 226.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.40 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|