C18H20Cl2N2 — CID 118713763
N-(3,4-dichlorophenyl)-N-(3-phenylpropyl)azetidin-3-amine (PubChem CID 118713763) has the molecular formula C18H20Cl2N2 and a molecular weight of 335.28 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N-(3-phenylpropyl)azetidin-3-amine.
| Compound Name | N-(3,4-dichlorophenyl)-N-(3-phenylpropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 118713763 |
| Molecular Formula | C18H20Cl2N2 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N-(3-phenylpropyl)azetidin-3-amine |
| SMILES | Clc1ccc(N(CCCc2ccccc2)C2CNC2)cc1Cl |
| InChI | InChI=1S/C18H20Cl2N2/c19-17-9-8-15(11-18(17)20)22(16-12-21-13-16)10-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-9,11,16,21H,4,7,10,12-13H2 |
| InChIKey | WXWLFJMECDDEAB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |