C17H18Cl2N2 — CID 118713776
N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline (PubChem CID 118713776) has the molecular formula C17H18Cl2N2 and a molecular weight of 321.25 g/mol. Its IUPAC name is N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline.
| Compound Name | N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline |
|---|---|
| PubChem CID | 118713776 |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline |
| SMILES | Clc1ccc(N(Cc2ccccc2)CC2CNC2)cc1Cl |
| InChI | InChI=1S/C17H18Cl2N2/c18-16-7-6-15(8-17(16)19)21(12-14-9-20-10-14)11-13-4-2-1-3-5-13/h1-8,14,20H,9-12H2 |
| InChIKey | UJPJRVGAMRAGHJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |