About N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline
N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline (PubChem CID 118713776) has the molecular formula C17H18Cl2N2
and a molecular weight of 321.25 g/mol. Its IUPAC name is N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline.
Molecular Properties
| Compound Name | N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline |
| PubChem CID | 118713776 |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline |
| SMILES | Clc1ccc(N(Cc2ccccc2)CC2CNC2)cc1Cl |
| InChI | InChI=1S/C17H18Cl2N2/c18-16-7-6-15(8-17(16)19)21(12-14-9-20-10-14)11-13-4-2-1-3-5-13/h1-8,14,20H,9-12H2 |
| InChIKey | UJPJRVGAMRAGHJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline?
The IUPAC name of N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline (CID 118713776) is N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline.
What is the SMILES notation for N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline?
The canonical SMILES for N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline is Clc1ccc(N(Cc2ccccc2)CC2CNC2)cc1Cl.
What is the InChIKey of N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline?
The InChIKey is UJPJRVGAMRAGHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2N2/c18-16-7-6-15(8-17(16)19)21(12-14-9-20-10-14)11-13-4-2-1-3-5-13/h1-8,14,20H,9-12H2.
What are the key properties of N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline?
N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline has a molecular weight of 321.25 g/mol, XLogP of 4.22, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azetidin-3-ylmethyl)-N-benzyl-3,4-dichloroaniline is sourced from PubChem (CID 118713776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).