C26H30O9 — CID 118713832
methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-2-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate (PubChem CID 118713832) has the molecular formula C26H30O9 and a molecular weight of 486.52 g/mol. Its IUPAC name is methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-2-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate.
| Compound Name | methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-2-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
|---|---|
| PubChem CID | 118713832 |
| Molecular Formula | C26H30O9 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-2-[(3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OC(C)=O)C(=O)[C@H]2[C@@]1(C)CC[C@H]1C(=O)O[C@H](CC3=CC(=O)C=CC3=O)C[C@]21C |
| InChI | InChI=1S/C26H30O9/c1-13(27)34-20-11-18(23(31)33-4)25(2)8-7-17-24(32)35-16(12-26(17,3)22(25)21(20)30)10-14-9-15(28)5-6-19(14)29/h5-6,9,16-18,20,22H,7-8,10-12H2,1-4H3/t16-,17+,18+,20+,22+,25+,26+/m1/s1 |
| InChIKey | BGFZJVOSAUXBPR-KQDZFTLOSA-N |
| XLogP | 2.06 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|