C32H50O5 — CID 118713839
3-[(1S,4R,5R,8S,9S,12S,13R)-5-[(2R,5S)-1-acetyloxy-5-hydroxy-6-methylhept-6-en-2-yl]-4,8-dimethyl-12-prop-1-en-2-yl-13-tetracyclo[7.5.0.01,13.04,8]tetradecanyl]propanoic acid (PubChem CID 118713839) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is 3-[(1S,4R,5R,8S,9S,12S,13R)-5-[(2R,5S)-1-acetyloxy-5-hydroxy-6-methylhept-6-en-2-yl]-4,8-dimethyl-12-prop-1-en-2-yl-13-tetracyclo[7.5.0.01,13.04,8]tetradecanyl]propanoic acid.
| Compound Name | 3-[(1S,4R,5R,8S,9S,12S,13R)-5-[(2R,5S)-1-acetyloxy-5-hydroxy-6-methylhept-6-en-2-yl]-4,8-dimethyl-12-prop-1-en-2-yl-13-tetracyclo[7.5.0.01,13.04,8]tetradecanyl]propanoic acid |
|---|---|
| PubChem CID | 118713839 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | 3-[(1S,4R,5R,8S,9S,12S,13R)-5-[(2R,5S)-1-acetyloxy-5-hydroxy-6-methylhept-6-en-2-yl]-4,8-dimethyl-12-prop-1-en-2-yl-13-tetracyclo[7.5.0.01,13.04,8]tetradecanyl]propanoic acid |
| SMILES | C=C(C)[C@@H](O)CC[C@@H](COC(C)=O)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@@H](C(=C)C)[C@@]4(CCC(=O)O)C[C@@]34CC[C@]12C |
| InChI | InChI=1S/C32H50O5/c1-20(2)24-9-11-27-30(7)14-12-25(23(18-37-22(5)33)8-10-26(34)21(3)4)29(30,6)16-17-32(27)19-31(24,32)15-13-28(35)36/h23-27,34H,1,3,8-19H2,2,4-7H3,(H,35,36)/t23-,24-,25+,26-,27-,29+,30-,31+,32-/m0/s1 |
| InChIKey | OFFRYODHDXULAB-FEHRRXGESA-N |
| XLogP | 6.94 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|