C27H42O9 — CID 118713841
methyl (Z)-7-[(1R,2R,3R,5S)-3-acetyloxy-2-[(E,3S)-3,6-diacetyloxyoct-1-enyl]-5-hydroxycyclopentyl]hept-5-enoate (PubChem CID 118713841) has the molecular formula C27H42O9 and a molecular weight of 510.62 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-3-acetyloxy-2-[(E,3S)-3,6-diacetyloxyoct-1-enyl]-5-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-3-acetyloxy-2-[(E,3S)-3,6-diacetyloxyoct-1-enyl]-5-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 118713841 |
| Molecular Formula | C27H42O9 |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-3-acetyloxy-2-[(E,3S)-3,6-diacetyloxyoct-1-enyl]-5-hydroxycyclopentyl]hept-5-enoate |
| SMILES | CCC(CC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)[C@@H](O)C[C@H]1OC(C)=O)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C27H42O9/c1-6-21(34-18(2)28)13-14-22(35-19(3)29)15-16-24-23(25(31)17-26(24)36-20(4)30)11-9-7-8-10-12-27(32)33-5/h7,9,15-16,21-26,31H,6,8,10-14,17H2,1-5H3/b9-7-,16-15+/t21?,22-,23+,24+,25-,26+/m0/s1 |
| InChIKey | IRWUSEQYOHQTHP-KHBMTRKYSA-N |
| XLogP | 3.81 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|