C37H49F3O11 — CID 118713843
methyl (Z)-7-[(1R,2R,3R,5S)-3,5-diacetyloxy-2-[(E,3S)-6-acetyloxy-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyoct-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 118713843) has the molecular formula C37H49F3O11 and a molecular weight of 726.78 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-3,5-diacetyloxy-2-[(E,3S)-6-acetyloxy-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyoct-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-3,5-diacetyloxy-2-[(E,3S)-6-acetyloxy-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyoct-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 118713843 |
| Molecular Formula | C37H49F3O11 |
| Molecular Weight | 726.78 g/mol |
| Exact Mass | 726.32 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-3,5-diacetyloxy-2-[(E,3S)-6-acetyloxy-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyoct-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCC(CC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)[C@@H](OC(C)=O)C[C@H]1OC(C)=O)OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)OC(C)=O |
| InChI | InChI=1S/C37H49F3O11/c1-7-28(48-24(2)41)19-20-29(51-35(45)36(47-6,37(38,39)40)27-15-11-10-12-16-27)21-22-31-30(17-13-8-9-14-18-34(44)46-5)32(49-25(3)42)23-33(31)50-26(4)43/h8,10-13,15-16,21-22,28-33H,7,9,14,17-20,23H2,1-6H3/b13-8-,22-21+/t28?,29-,30+,31+,32-,33+,36-/m0/s1 |
| InChIKey | HTENUTNBKDPWHM-ZIEPBBMUSA-N |
| XLogP | 6.47 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.78 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|