C16H19N3OS — CID 118713900
(2E)-3-benzyl-2-(cyclohexylidenehydrazinylidene)-1,3-thiazolidin-4-one (PubChem CID 118713900) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is (2E)-3-benzyl-2-(cyclohexylidenehydrazinylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2E)-3-benzyl-2-(cyclohexylidenehydrazinylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118713900 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (2E)-3-benzyl-2-(cyclohexylidenehydrazinylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N/N=C2CCCCC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H19N3OS/c20-15-12-21-16(18-17-14-9-5-2-6-10-14)19(15)11-13-7-3-1-4-8-13/h1,3-4,7-8H,2,5-6,9-12H2/b18-16+ |
| InChIKey | AHUSKJSJTBPIMH-FBMGVBCBSA-N |
| XLogP | 3.44 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|