About N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide
N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 118713954) has the molecular formula C11H11BrN2O2
and a molecular weight of 283.12 g/mol. Its IUPAC name is N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide |
| PubChem CID | 118713954 |
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CC(Br)=NO1 |
| InChI | InChI=1S/C11H11BrN2O2/c12-10-6-9(16-14-10)11(15)13-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,15) |
| InChIKey | YGMLVQUVJVKGMK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide?
The IUPAC name of N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide (CID 118713954) is N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide is O=C(NCc1ccccc1)C1CC(Br)=NO1.
What is the InChIKey of N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide?
The InChIKey is YGMLVQUVJVKGMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN2O2/c12-10-6-9(16-14-10)11(15)13-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,15).
What are the key properties of N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide?
N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide has a molecular weight of 283.12 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-bromo-4,5-dihydro-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 118713954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).