About 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine
4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine (PubChem CID 118714017) has the molecular formula C25H30Cl2N2
and a molecular weight of 429.44 g/mol. Its IUPAC name is 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine |
| PubChem CID | 118714017 |
| Molecular Formula | C25H30Cl2N2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine |
| SMILES | Clc1ccc(C(CCN2CC=C(Cc3ccccc3)CC2)N2CCCC2)cc1Cl |
| InChI | InChI=1S/C25H30Cl2N2/c26-23-9-8-22(19-24(23)27)25(29-13-4-5-14-29)12-17-28-15-10-21(11-16-28)18-20-6-2-1-3-7-20/h1-3,6-10,19,25H,4-5,11-18H2 |
| InChIKey | AAXDLPLNFKHHPR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine?
The IUPAC name of 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine (CID 118714017) is 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine is Clc1ccc(C(CCN2CC=C(Cc3ccccc3)CC2)N2CCCC2)cc1Cl.
What is the InChIKey of 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine?
The InChIKey is AAXDLPLNFKHHPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30Cl2N2/c26-23-9-8-22(19-24(23)27)25(29-13-4-5-14-29)12-17-28-15-10-21(11-16-28)18-20-6-2-1-3-7-20/h1-3,6-10,19,25H,4-5,11-18H2.
What are the key properties of 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine?
4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine has a molecular weight of 429.44 g/mol, XLogP of 6.40, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-1-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 118714017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).