C19H18Cl2N4O6 — CID 118714080
ethyl 6,8-dichloro-1-[2-hydroxy-3-(2-methyl-5-nitroimidazol-1-yl)propyl]-4-oxoquinoline-3-carboxylate (PubChem CID 118714080) has the molecular formula C19H18Cl2N4O6 and a molecular weight of 469.28 g/mol. Its IUPAC name is ethyl 6,8-dichloro-1-[2-hydroxy-3-(2-methyl-5-nitroimidazol-1-yl)propyl]-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 6,8-dichloro-1-[2-hydroxy-3-(2-methyl-5-nitroimidazol-1-yl)propyl]-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 118714080 |
| Molecular Formula | C19H18Cl2N4O6 |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | ethyl 6,8-dichloro-1-[2-hydroxy-3-(2-methyl-5-nitroimidazol-1-yl)propyl]-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CC(O)Cn2c([N+](=O)[O-])cnc2C)c2c(Cl)cc(Cl)cc2c1=O |
| InChI | InChI=1S/C19H18Cl2N4O6/c1-3-31-19(28)14-9-23(17-13(18(14)27)4-11(20)5-15(17)21)7-12(26)8-24-10(2)22-6-16(24)25(29)30/h4-6,9,12,26H,3,7-8H2,1-2H3 |
| InChIKey | CMAOUCYIMBFWDO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|