About [5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol
[5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol (PubChem CID 118714122) has the molecular formula C23H20N2O4
and a molecular weight of 388.42 g/mol. Its IUPAC name is [5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol.
Molecular Properties
| Compound Name | [5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol |
| PubChem CID | 118714122 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol |
| SMILES | COc1ccc(-c2c(CO)n(Cc3ccccc3)c3cc4c(cc23)OCO4)cn1 |
| InChI | InChI=1S/C23H20N2O4/c1-27-22-8-7-16(11-24-22)23-17-9-20-21(29-14-28-20)10-18(17)25(19(23)13-26)12-15-5-3-2-4-6-15/h2-11,26H,12-14H2,1H3 |
| InChIKey | TYIPRAJVKHNCMD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol?
The IUPAC name of [5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol (CID 118714122) is [5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol.
What is the SMILES notation for [5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol?
The canonical SMILES for [5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol is COc1ccc(-c2c(CO)n(Cc3ccccc3)c3cc4c(cc23)OCO4)cn1.
What is the InChIKey of [5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol?
The InChIKey is TYIPRAJVKHNCMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O4/c1-27-22-8-7-16(11-24-22)23-17-9-20-21(29-14-28-20)10-18(17)25(19(23)13-26)12-15-5-3-2-4-6-15/h2-11,26H,12-14H2,1H3.
What are the key properties of [5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol?
[5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol has a molecular weight of 388.42 g/mol, XLogP of 3.98, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-benzyl-7-(6-methoxy-3-pyridinyl)-[1,3]dioxolo[4,5-f]indol-6-yl]methanol is sourced from PubChem (CID 118714122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).