About N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide
N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide (PubChem CID 118714232) has the molecular formula C20H17F2N3O
and a molecular weight of 353.37 g/mol. Its IUPAC name is N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide.
Molecular Properties
| Compound Name | N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide |
| PubChem CID | 118714232 |
| Molecular Formula | C20H17F2N3O |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide |
| SMILES | N/C(CC(O)c1cccc2ccccc12)=N\N=C\c1ccc(F)cc1F |
| InChI | InChI=1S/C20H17F2N3O/c21-15-9-8-14(18(22)10-15)12-24-25-20(23)11-19(26)17-7-3-5-13-4-1-2-6-16(13)17/h1-10,12,19,26H,11H2,(H2,23,25)/b24-12+ |
| InChIKey | SLGGKLJVAASYEB-WYMPLXKRSA-N |
| XLogP | 3.93 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide?
The IUPAC name of N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide (CID 118714232) is N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide.
What is the SMILES notation for N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide?
The canonical SMILES for N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide is N/C(CC(O)c1cccc2ccccc12)=N\N=C\c1ccc(F)cc1F.
What is the InChIKey of N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide?
The InChIKey is SLGGKLJVAASYEB-WYMPLXKRSA-N. The full InChI is InChI=1S/C20H17F2N3O/c21-15-9-8-14(18(22)10-15)12-24-25-20(23)11-19(26)17-7-3-5-13-4-1-2-6-16(13)17/h1-10,12,19,26H,11H2,(H2,23,25)/b24-12+.
What are the key properties of N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide?
N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide has a molecular weight of 353.37 g/mol, XLogP of 3.93, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-(2,4-difluorophenyl)methylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide is sourced from PubChem (CID 118714232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).