C20H22N4O4 — CID 118714274
4-(1-benzofuran-2-carbonylamino)-N-(4-methoxycyclohexyl)-1H-pyrazole-5-carboxamide (PubChem CID 118714274) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-(1-benzofuran-2-carbonylamino)-N-(4-methoxycyclohexyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-(1-benzofuran-2-carbonylamino)-N-(4-methoxycyclohexyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 118714274 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 4-(1-benzofuran-2-carbonylamino)-N-(4-methoxycyclohexyl)-1H-pyrazole-5-carboxamide |
| SMILES | COC1CCC(NC(=O)c2[nH]ncc2NC(=O)c2cc3ccccc3o2)CC1 |
| InChI | InChI=1S/C20H22N4O4/c1-27-14-8-6-13(7-9-14)22-20(26)18-15(11-21-24-18)23-19(25)17-10-12-4-2-3-5-16(12)28-17/h2-5,10-11,13-14H,6-9H2,1H3,(H,21,24)(H,22,26)(H,23,25) |
| InChIKey | MPPIFPJGAIUWJF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |