About N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide
N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 118714282) has the molecular formula C19H24N4O4
and a molecular weight of 372.43 g/mol. Its IUPAC name is N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide |
| PubChem CID | 118714282 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1cn[nH]c1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H24N4O4/c1-26-14-9-6-10-15(27-2)16(14)18(24)22-13-11-20-23-17(13)19(25)21-12-7-4-3-5-8-12/h6,9-12H,3-5,7-8H2,1-2H3,(H,20,23)(H,21,25)(H,22,24) |
| InChIKey | RRYFECCPZIZXEK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide?
The IUPAC name of N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide (CID 118714282) is N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide.
What is the SMILES notation for N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide?
The canonical SMILES for N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide is COc1cccc(OC)c1C(=O)Nc1cn[nH]c1C(=O)NC1CCCCC1.
What is the InChIKey of N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide?
The InChIKey is RRYFECCPZIZXEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N4O4/c1-26-14-9-6-10-15(27-2)16(14)18(24)22-13-11-20-23-17(13)19(25)21-12-7-4-3-5-8-12/h6,9-12H,3-5,7-8H2,1-2H3,(H,20,23)(H,21,25)(H,22,24).
What are the key properties of N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide?
N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide has a molecular weight of 372.43 g/mol, XLogP of 2.74, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 118714282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).