About N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide
N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 118714283) has the molecular formula C20H26N4O4
and a molecular weight of 386.45 g/mol. Its IUPAC name is N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide |
| PubChem CID | 118714283 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1cn[nH]c1C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C20H26N4O4/c1-27-15-10-7-11-16(28-2)17(15)19(25)23-14-12-21-24-18(14)20(26)22-13-8-5-3-4-6-9-13/h7,10-13H,3-6,8-9H2,1-2H3,(H,21,24)(H,22,26)(H,23,25) |
| InChIKey | XVHXYPREJYNIQE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide?
The IUPAC name of N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide (CID 118714283) is N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide.
What is the SMILES notation for N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide?
The canonical SMILES for N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide is COc1cccc(OC)c1C(=O)Nc1cn[nH]c1C(=O)NC1CCCCCC1.
What is the InChIKey of N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide?
The InChIKey is XVHXYPREJYNIQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O4/c1-27-15-10-7-11-16(28-2)17(15)19(25)23-14-12-21-24-18(14)20(26)22-13-8-5-3-4-6-9-13/h7,10-13H,3-6,8-9H2,1-2H3,(H,21,24)(H,22,26)(H,23,25).
What are the key properties of N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide?
N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide has a molecular weight of 386.45 g/mol, XLogP of 3.13, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-4-[(2,6-dimethoxybenzoyl)amino]-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 118714283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).