C8H12O6S2 — CID 11871441
(1S,3R,7S,9R)-2,8-dioxa-5λ6,11λ6-dithiatricyclo[7.3.0.03,7]dodecane 5,5,11,11-tetraoxide (PubChem CID 11871441) has the molecular formula C8H12O6S2 and a molecular weight of 268.31 g/mol. Its IUPAC name is (1S,3R,7S,9R)-2,8-dioxa-5λ6,11λ6-dithiatricyclo[7.3.0.03,7]dodecane 5,5,11,11-tetraoxide.
| Compound Name | (1S,3R,7S,9R)-2,8-dioxa-5λ6,11λ6-dithiatricyclo[7.3.0.03,7]dodecane 5,5,11,11-tetraoxide |
|---|---|
| PubChem CID | 11871441 |
| Molecular Formula | C8H12O6S2 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | (1S,3R,7S,9R)-2,8-dioxa-5λ6,11λ6-dithiatricyclo[7.3.0.03,7]dodecane 5,5,11,11-tetraoxide |
| SMILES | O=S1(=O)C[C@@H]2O[C@@H]3CS(=O)(=O)C[C@@H]3O[C@@H]2C1 |
| InChI | InChI=1S/C8H12O6S2/c9-15(10)1-5-6(2-15)14-8-4-16(11,12)3-7(8)13-5/h5-8H,1-4H2/t5-,6+,7+,8- |
| InChIKey | GTZVEFNTTZDOIJ-SOSBWXJGSA-N |
| XLogP | -1.64 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |