C18H19NO3 — CID 118714680
(5R,6S,7R)-5-hydroxy-1',6-dimethylspiro[2,3,5,6-tetrahydro-1H-indene-7,3'-indole]-2',4-dione (PubChem CID 118714680) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (5R,6S,7R)-5-hydroxy-1',6-dimethylspiro[2,3,5,6-tetrahydro-1H-indene-7,3'-indole]-2',4-dione.
| Compound Name | (5R,6S,7R)-5-hydroxy-1',6-dimethylspiro[2,3,5,6-tetrahydro-1H-indene-7,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 118714680 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (5R,6S,7R)-5-hydroxy-1',6-dimethylspiro[2,3,5,6-tetrahydro-1H-indene-7,3'-indole]-2',4-dione |
| SMILES | C[C@@H]1[C@@H](O)C(=O)C2=C(CCC2)[C@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C18H19NO3/c1-10-15(20)16(21)11-6-5-8-12(11)18(10)13-7-3-4-9-14(13)19(2)17(18)22/h3-4,7,9-10,15,20H,5-6,8H2,1-2H3/t10-,15-,18-/m1/s1 |
| InChIKey | XYZWUTVMGFJRHN-QEIWDELWSA-N |
| XLogP | 1.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |