C17H26O10 — CID 118714804
methyl (3S,3aS,4R,5S,6aS)-5-methyl-2-oxo-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-carboxylate (PubChem CID 118714804) has the molecular formula C17H26O10 and a molecular weight of 390.39 g/mol. Its IUPAC name is methyl (3S,3aS,4R,5S,6aS)-5-methyl-2-oxo-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-carboxylate.
| Compound Name | methyl (3S,3aS,4R,5S,6aS)-5-methyl-2-oxo-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-carboxylate |
|---|---|
| PubChem CID | 118714804 |
| Molecular Formula | C17H26O10 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | methyl (3S,3aS,4R,5S,6aS)-5-methyl-2-oxo-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)O[C@H]2C[C@H](C)[C@@H](CO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]12 |
| InChI | InChI=1S/C17H26O10/c1-6-3-8-10(11(15(22)24-2)16(23)26-8)7(6)5-25-17-14(21)13(20)12(19)9(4-18)27-17/h6-14,17-21H,3-5H2,1-2H3/t6-,7+,8-,9+,10+,11-,12+,13-,14+,17+/m0/s1 |
| InChIKey | BYAUOAQLDKGCIR-HLMYAEIBSA-N |
| XLogP | -2.21 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|