C10H12O4 — CID 118714805
(1S,4S,6S,7R,11S)-6-methyl-3,9-dioxatricyclo[5.3.1.04,11]undecane-2,10-dione (PubChem CID 118714805) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (1S,4S,6S,7R,11S)-6-methyl-3,9-dioxatricyclo[5.3.1.04,11]undecane-2,10-dione.
| Compound Name | (1S,4S,6S,7R,11S)-6-methyl-3,9-dioxatricyclo[5.3.1.04,11]undecane-2,10-dione |
|---|---|
| PubChem CID | 118714805 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (1S,4S,6S,7R,11S)-6-methyl-3,9-dioxatricyclo[5.3.1.04,11]undecane-2,10-dione |
| SMILES | C[C@H]1C[C@@H]2OC(=O)[C@@H]3C(=O)OC[C@H]1[C@@H]32 |
| InChI | InChI=1S/C10H12O4/c1-4-2-6-7-5(4)3-13-9(11)8(7)10(12)14-6/h4-8H,2-3H2,1H3/t4-,5+,6-,7+,8-/m0/s1 |
| InChIKey | UAXMDBXWWFRSAK-YMVPXFTJSA-N |
| XLogP | 0.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|