C41H48N2O6+2 — CID 118714930
(1E,6E)-1,7-bis[3-methoxy-4-(5-pyridin-1-ium-1-ylpentoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 118714930) has the molecular formula C41H48N2O6+2 and a molecular weight of 664.84 g/mol. Its IUPAC name is (1E,6E)-1,7-bis[3-methoxy-4-(5-pyridin-1-ium-1-ylpentoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis[3-methoxy-4-(5-pyridin-1-ium-1-ylpentoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 118714930 |
| Molecular Formula | C41H48N2O6+2 |
| Molecular Weight | 664.84 g/mol |
| Exact Mass | 664.35 |
| IUPAC Name | (1E,6E)-1,7-bis[3-methoxy-4-(5-pyridin-1-ium-1-ylpentoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OCCCCC[n+]3ccccc3)c(OC)c2)ccc1OCCCCC[n+]1ccccc1 |
| InChI | InChI=1S/C41H48N2O6/c1-46-40-31-34(17-21-38(40)48-29-13-5-11-27-42-23-7-3-8-24-42)15-19-36(44)33-37(45)20-16-35-18-22-39(41(32-35)47-2)49-30-14-6-12-28-43-25-9-4-10-26-43/h3-4,7-10,15-26,31-32H,5-6,11-14,27-30,33H2,1-2H3/q+2/b19-15+,20-16+ |
| InChIKey | RPZOHFLNSQKKCW-MXWIWYRXSA-N |
| XLogP | 7.03 |
| TPSA | 78.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.84 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|