C27H36O7S — CID 118715010
[(1S,3S,5S,9S,10S,11S,12R,14R,17R)-14-ethenyl-10-hydroxy-8,8,12,14,17-pentamethyl-16-oxo-3-thiophen-2-yl-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadecan-11-yl] acetate (PubChem CID 118715010) has the molecular formula C27H36O7S and a molecular weight of 504.65 g/mol. Its IUPAC name is [(1S,3S,5S,9S,10S,11S,12R,14R,17R)-14-ethenyl-10-hydroxy-8,8,12,14,17-pentamethyl-16-oxo-3-thiophen-2-yl-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadecan-11-yl] acetate.
| Compound Name | [(1S,3S,5S,9S,10S,11S,12R,14R,17R)-14-ethenyl-10-hydroxy-8,8,12,14,17-pentamethyl-16-oxo-3-thiophen-2-yl-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadecan-11-yl] acetate |
|---|---|
| PubChem CID | 118715010 |
| Molecular Formula | C27H36O7S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | [(1S,3S,5S,9S,10S,11S,12R,14R,17R)-14-ethenyl-10-hydroxy-8,8,12,14,17-pentamethyl-16-oxo-3-thiophen-2-yl-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadecan-11-yl] acetate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@@]23O[C@@H](c4cccs4)O[C@H]4CCC(C)(C)[C@H]([C@H](O)[C@H](OC(C)=O)[C@@]2(C)O1)[C@]43C |
| InChI | InChI=1S/C27H36O7S/c1-8-24(5)14-17(29)27-25(6)18(32-22(33-27)16-10-9-13-35-16)11-12-23(3,4)20(25)19(30)21(31-15(2)28)26(27,7)34-24/h8-10,13,18-22,30H,1,11-12,14H2,2-7H3/t18-,19-,20-,21-,22-,24-,25-,26+,27-/m0/s1 |
| InChIKey | QOLLKRZRAQCBNV-TYWIGYSASA-N |
| XLogP | 4.34 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|