C27H36O6 — CID 118715013
(1S,3S,5S,9S,10S,11S,12R,14R,17R)-14-ethenyl-10,11-dihydroxy-8,8,12,14,17-pentamethyl-3-phenyl-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadecan-16-one (PubChem CID 118715013) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is (1S,3S,5S,9S,10S,11S,12R,14R,17R)-14-ethenyl-10,11-dihydroxy-8,8,12,14,17-pentamethyl-3-phenyl-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadecan-16-one.
| Compound Name | (1S,3S,5S,9S,10S,11S,12R,14R,17R)-14-ethenyl-10,11-dihydroxy-8,8,12,14,17-pentamethyl-3-phenyl-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadecan-16-one |
|---|---|
| PubChem CID | 118715013 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (1S,3S,5S,9S,10S,11S,12R,14R,17R)-14-ethenyl-10,11-dihydroxy-8,8,12,14,17-pentamethyl-3-phenyl-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadecan-16-one |
| SMILES | C=C[C@@]1(C)CC(=O)[C@@]23O[C@@H](c4ccccc4)O[C@H]4CCC(C)(C)[C@H]([C@H](O)[C@H](O)[C@@]2(C)O1)[C@]43C |
| InChI | InChI=1S/C27H36O6/c1-7-24(4)15-17(28)27-25(5)18(31-22(32-27)16-11-9-8-10-12-16)13-14-23(2,3)20(25)19(29)21(30)26(27,6)33-24/h7-12,18-22,29-30H,1,13-15H2,2-6H3/t18-,19-,20-,21-,22-,24-,25-,26+,27-/m0/s1 |
| InChIKey | KJFOFMVJVJAORO-TYWIGYSASA-N |
| XLogP | 3.71 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|