C29H38O7 — CID 118715015
[(1S,3S,5S,9S,10S,11S,12R,14R,17R)-14-ethenyl-11-hydroxy-8,8,12,14,17-pentamethyl-16-oxo-3-phenyl-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadecan-10-yl] acetate (PubChem CID 118715015) has the molecular formula C29H38O7 and a molecular weight of 498.62 g/mol. Its IUPAC name is [(1S,3S,5S,9S,10S,11S,12R,14R,17R)-14-ethenyl-11-hydroxy-8,8,12,14,17-pentamethyl-16-oxo-3-phenyl-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadecan-10-yl] acetate.
| Compound Name | [(1S,3S,5S,9S,10S,11S,12R,14R,17R)-14-ethenyl-11-hydroxy-8,8,12,14,17-pentamethyl-16-oxo-3-phenyl-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadecan-10-yl] acetate |
|---|---|
| PubChem CID | 118715015 |
| Molecular Formula | C29H38O7 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [(1S,3S,5S,9S,10S,11S,12R,14R,17R)-14-ethenyl-11-hydroxy-8,8,12,14,17-pentamethyl-16-oxo-3-phenyl-2,4,13-trioxatetracyclo[7.7.1.01,12.05,17]heptadecan-10-yl] acetate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@@]23O[C@@H](c4ccccc4)O[C@H]4CCC(C)(C)[C@H]([C@H](OC(C)=O)[C@H](O)[C@@]2(C)O1)[C@]43C |
| InChI | InChI=1S/C29H38O7/c1-8-26(5)16-19(31)29-27(6)20(34-24(35-29)18-12-10-9-11-13-18)14-15-25(3,4)22(27)21(33-17(2)30)23(32)28(29,7)36-26/h8-13,20-24,32H,1,14-16H2,2-7H3/t20-,21-,22-,23-,24-,26-,27-,28+,29-/m0/s1 |
| InChIKey | CUEMBARRVXUTBR-ZATIZILZSA-N |
| XLogP | 4.28 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|