About N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine
N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 118715020) has the molecular formula C22H23N3OS
and a molecular weight of 377.51 g/mol. Its IUPAC name is N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine.
Molecular Properties
| Compound Name | N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine |
| PubChem CID | 118715020 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | COc1ccc(-c2nc3scc(-c4ccccc4)n3c2NC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H23N3OS/c1-22(2,3)24-20-19(16-10-12-17(26-4)13-11-16)23-21-25(20)18(14-27-21)15-8-6-5-7-9-15/h5-14,24H,1-4H3 |
| InChIKey | JUJQNTHMHRCRRK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine?
The IUPAC name of N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine (CID 118715020) is N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine.
What is the SMILES notation for N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine?
The canonical SMILES for N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine is COc1ccc(-c2nc3scc(-c4ccccc4)n3c2NC(C)(C)C)cc1.
What is the InChIKey of N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine?
The InChIKey is JUJQNTHMHRCRRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3OS/c1-22(2,3)24-20-19(16-10-12-17(26-4)13-11-16)23-21-25(20)18(14-27-21)15-8-6-5-7-9-15/h5-14,24H,1-4H3.
What are the key properties of N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine?
N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine has a molecular weight of 377.51 g/mol, XLogP of 5.95, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-6-(4-methoxyphenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine is sourced from PubChem (CID 118715020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).