C22H26N2O3 — CID 118715142
(1S,12S,13R,16S,20S,21R)-3,16,23-trimethyl-15,17-dioxa-3,23-diazahexacyclo[10.10.1.02,10.04,9.013,21.016,20]tricosa-2(10),4,6,8-tetraen-18-one (PubChem CID 118715142) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (1S,12S,13R,16S,20S,21R)-3,16,23-trimethyl-15,17-dioxa-3,23-diazahexacyclo[10.10.1.02,10.04,9.013,21.016,20]tricosa-2(10),4,6,8-tetraen-18-one.
| Compound Name | (1S,12S,13R,16S,20S,21R)-3,16,23-trimethyl-15,17-dioxa-3,23-diazahexacyclo[10.10.1.02,10.04,9.013,21.016,20]tricosa-2(10),4,6,8-tetraen-18-one |
|---|---|
| PubChem CID | 118715142 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (1S,12S,13R,16S,20S,21R)-3,16,23-trimethyl-15,17-dioxa-3,23-diazahexacyclo[10.10.1.02,10.04,9.013,21.016,20]tricosa-2(10),4,6,8-tetraen-18-one |
| SMILES | CN1[C@H]2C[C@@H]3[C@@H](CO[C@@]4(C)OC(=O)C[C@@H]34)[C@@H]1Cc1c2n(C)c2ccccc12 |
| InChI | InChI=1S/C22H26N2O3/c1-22-16(10-20(25)27-22)13-8-19-21-14(9-18(23(19)2)15(13)11-26-22)12-6-4-5-7-17(12)24(21)3/h4-7,13,15-16,18-19H,8-11H2,1-3H3/t13-,15-,16+,18+,19+,22+/m1/s1 |
| InChIKey | HIJSJXVEJVBFFC-ZPPAPSBDSA-N |
| XLogP | 3.02 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|