C25H26O7 — CID 118715263
(E)-1-[5,8-dihydroxy-2-(3-hydroxy-4-methylpent-4-enyl)-2-methylchromen-6-yl]-3-(2,5-dihydroxyphenyl)prop-2-en-1-one (PubChem CID 118715263) has the molecular formula C25H26O7 and a molecular weight of 438.48 g/mol. Its IUPAC name is (E)-1-[5,8-dihydroxy-2-(3-hydroxy-4-methylpent-4-enyl)-2-methylchromen-6-yl]-3-(2,5-dihydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[5,8-dihydroxy-2-(3-hydroxy-4-methylpent-4-enyl)-2-methylchromen-6-yl]-3-(2,5-dihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 118715263 |
| Molecular Formula | C25H26O7 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (E)-1-[5,8-dihydroxy-2-(3-hydroxy-4-methylpent-4-enyl)-2-methylchromen-6-yl]-3-(2,5-dihydroxyphenyl)prop-2-en-1-one |
| SMILES | C=C(C)C(O)CCC1(C)C=Cc2c(O)c(C(=O)/C=C/c3cc(O)ccc3O)cc(O)c2O1 |
| InChI | InChI=1S/C25H26O7/c1-14(2)19(27)9-11-25(3)10-8-17-23(31)18(13-22(30)24(17)32-25)21(29)6-4-15-12-16(26)5-7-20(15)28/h4-8,10,12-13,19,26-28,30-31H,1,9,11H2,2-3H3/b6-4+ |
| InChIKey | XWIVKPPMRDTBDG-GQCTYLIASA-N |
| XLogP | 4.29 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|