C35H36O5S — CID 118715659
(2R,3S,4R,4aS,6R,10bS)-9-methyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide (PubChem CID 118715659) has the molecular formula C35H36O5S and a molecular weight of 568.74 g/mol. Its IUPAC name is (2R,3S,4R,4aS,6R,10bS)-9-methyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide.
| Compound Name | (2R,3S,4R,4aS,6R,10bS)-9-methyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide |
|---|---|
| PubChem CID | 118715659 |
| Molecular Formula | C35H36O5S |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | (2R,3S,4R,4aS,6R,10bS)-9-methyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide |
| SMILES | Cc1ccc2c(c1)[C@H]1O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]1C[S@]2=O |
| InChI | InChI=1S/C35H36O5S/c1-25-17-18-32-29(19-25)33-30(24-41(32)36)34(38-21-27-13-7-3-8-14-27)35(39-22-28-15-9-4-10-16-28)31(40-33)23-37-20-26-11-5-2-6-12-26/h2-19,30-31,33-35H,20-24H2,1H3/t30-,31+,33+,34+,35+,41+/m0/s1 |
| InChIKey | OMFZAGSVVYZTNA-FPXOXZTKSA-N |
| XLogP | 6.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |