C38H42O5S — CID 118715661
(2R,3S,4R,4aS,6R,10bS)-9-tert-butyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide (PubChem CID 118715661) has the molecular formula C38H42O5S and a molecular weight of 610.82 g/mol. Its IUPAC name is (2R,3S,4R,4aS,6R,10bS)-9-tert-butyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide.
| Compound Name | (2R,3S,4R,4aS,6R,10bS)-9-tert-butyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide |
|---|---|
| PubChem CID | 118715661 |
| Molecular Formula | C38H42O5S |
| Molecular Weight | 610.82 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | (2R,3S,4R,4aS,6R,10bS)-9-tert-butyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide |
| SMILES | CC(C)(C)c1ccc2c(c1)[C@H]1O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]1C[S@]2=O |
| InChI | InChI=1S/C38H42O5S/c1-38(2,3)30-19-20-34-31(21-30)35-32(26-44(34)39)36(41-23-28-15-9-5-10-16-28)37(42-24-29-17-11-6-12-18-29)33(43-35)25-40-22-27-13-7-4-8-14-27/h4-21,32-33,35-37H,22-26H2,1-3H3/t32-,33+,35+,36+,37+,44+/m0/s1 |
| InChIKey | RXFAHKLWPNPNLF-DHNWLGSSSA-N |
| XLogP | 7.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.82 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |