C17H24O6S — CID 118715666
(2R,3S,4R,4aR,10bS)-9-tert-butyl-2-(hydroxymethyl)-6,6-dioxo-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran-3,4-diol (PubChem CID 118715666) has the molecular formula C17H24O6S and a molecular weight of 356.44 g/mol. Its IUPAC name is (2R,3S,4R,4aR,10bS)-9-tert-butyl-2-(hydroxymethyl)-6,6-dioxo-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran-3,4-diol.
| Compound Name | (2R,3S,4R,4aR,10bS)-9-tert-butyl-2-(hydroxymethyl)-6,6-dioxo-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran-3,4-diol |
|---|---|
| PubChem CID | 118715666 |
| Molecular Formula | C17H24O6S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (2R,3S,4R,4aR,10bS)-9-tert-butyl-2-(hydroxymethyl)-6,6-dioxo-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran-3,4-diol |
| SMILES | CC(C)(C)c1ccc2c(c1)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1CS2(=O)=O |
| InChI | InChI=1S/C17H24O6S/c1-17(2,3)9-4-5-13-10(6-9)16-11(8-24(13,21)22)14(19)15(20)12(7-18)23-16/h4-6,11-12,14-16,18-20H,7-8H2,1-3H3/t11-,12-,14-,15-,16-/m1/s1 |
| InChIKey | WYLKZIHBHVORSP-CCECPURYSA-N |
| XLogP | 0.54 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |