C22H20O6 — CID 118715696
[(2R,3S,3aS,6aR)-2-[(S)-hydroxy(phenyl)methyl]-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] (E)-3-phenylprop-2-enoate (PubChem CID 118715696) has the molecular formula C22H20O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is [(2R,3S,3aS,6aR)-2-[(S)-hydroxy(phenyl)methyl]-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R,3S,3aS,6aR)-2-[(S)-hydroxy(phenyl)methyl]-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 118715696 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [(2R,3S,3aS,6aR)-2-[(S)-hydroxy(phenyl)methyl]-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)O[C@@H]1[C@H]2OC(=O)C[C@H]2O[C@@H]1[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C22H20O6/c23-17(12-11-14-7-3-1-4-8-14)27-22-20-16(13-18(24)28-20)26-21(22)19(25)15-9-5-2-6-10-15/h1-12,16,19-22,25H,13H2/b12-11+/t16-,19+,20+,21-,22-/m1/s1 |
| InChIKey | FHGDRFDHIZAQKE-XIDGZMOSSA-N |
| XLogP | 2.43 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|