C21H25N5O3S — CID 118715742
N-[4-(3,4-dimethylanilino)thieno[2,3-d]pyrimidin-6-yl]-N'-hydroxyheptanediamide (PubChem CID 118715742) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[4-(3,4-dimethylanilino)thieno[2,3-d]pyrimidin-6-yl]-N'-hydroxyheptanediamide.
| Compound Name | N-[4-(3,4-dimethylanilino)thieno[2,3-d]pyrimidin-6-yl]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 118715742 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[4-(3,4-dimethylanilino)thieno[2,3-d]pyrimidin-6-yl]-N'-hydroxyheptanediamide |
| SMILES | Cc1ccc(Nc2ncnc3sc(NC(=O)CCCCCC(=O)NO)cc23)cc1C |
| InChI | InChI=1S/C21H25N5O3S/c1-13-8-9-15(10-14(13)2)24-20-16-11-19(30-21(16)23-12-22-20)25-17(27)6-4-3-5-7-18(28)26-29/h8-12,29H,3-7H2,1-2H3,(H,25,27)(H,26,28)(H,22,23,24) |
| InChIKey | ZVGOWTOAXUNEFF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|