C21H20ClIN2O — CID 118715803
N-[(E)-(5-chloro-2,3-dimethyl-8,9-dihydro-7H-benzo[7]annulen-6-yl)methylideneamino]-3-iodobenzamide (PubChem CID 118715803) has the molecular formula C21H20ClIN2O and a molecular weight of 478.76 g/mol. Its IUPAC name is N-[(E)-(5-chloro-2,3-dimethyl-8,9-dihydro-7H-benzo[7]annulen-6-yl)methylideneamino]-3-iodobenzamide.
| Compound Name | N-[(E)-(5-chloro-2,3-dimethyl-8,9-dihydro-7H-benzo[7]annulen-6-yl)methylideneamino]-3-iodobenzamide |
|---|---|
| PubChem CID | 118715803 |
| Molecular Formula | C21H20ClIN2O |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | N-[(E)-(5-chloro-2,3-dimethyl-8,9-dihydro-7H-benzo[7]annulen-6-yl)methylideneamino]-3-iodobenzamide |
| SMILES | Cc1cc2c(cc1C)C(Cl)=C(/C=N/NC(=O)c1cccc(I)c1)CCC2 |
| InChI | InChI=1S/C21H20ClIN2O/c1-13-9-15-5-3-7-17(20(22)19(15)10-14(13)2)12-24-25-21(26)16-6-4-8-18(23)11-16/h4,6,8-12H,3,5,7H2,1-2H3,(H,25,26)/b24-12+ |
| InChIKey | FPBZXCLWCHGOEW-WYMPLXKRSA-N |
| XLogP | 5.61 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|