About (7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one
(7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one (PubChem CID 118715872) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is (7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one.
Molecular Properties
| Compound Name | (7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one |
| PubChem CID | 118715872 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one |
| SMILES | Cc1ccc(CC(=O)[C@@H]2Cc3cncn3C(=O)N2)cc1 |
| InChI | InChI=1S/C15H15N3O2/c1-10-2-4-11(5-3-10)6-14(19)13-7-12-8-16-9-18(12)15(20)17-13/h2-5,8-9,13H,6-7H2,1H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | PIGCCWWBGOHCRI-ZDUSSCGKSA-N |
| XLogP | 1.49 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one?
The IUPAC name of (7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one (CID 118715872) is (7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one.
What is the SMILES notation for (7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one?
The canonical SMILES for (7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one is Cc1ccc(CC(=O)[C@@H]2Cc3cncn3C(=O)N2)cc1.
What is the InChIKey of (7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one?
The InChIKey is PIGCCWWBGOHCRI-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H15N3O2/c1-10-2-4-11(5-3-10)6-14(19)13-7-12-8-16-9-18(12)15(20)17-13/h2-5,8-9,13H,6-7H2,1H3,(H,17,20)/t13-/m0/s1.
What are the key properties of (7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one?
(7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one has a molecular weight of 269.30 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-7-[2-(4-methylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one is sourced from PubChem (CID 118715872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).