About (7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one
(7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one (PubChem CID 118715874) has the molecular formula C20H17N3O2
and a molecular weight of 331.38 g/mol. Its IUPAC name is (7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one.
Molecular Properties
| Compound Name | (7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one |
| PubChem CID | 118715874 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)[C@@H]1Cc2cncn2C(=O)N1 |
| InChI | InChI=1S/C20H17N3O2/c24-19(18-11-17-12-21-13-23(17)20(25)22-18)10-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h1-9,12-13,18H,10-11H2,(H,22,25)/t18-/m0/s1 |
| InChIKey | YVUPHUSLEFTSKX-SFHVURJKSA-N |
| XLogP | 2.84 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one?
The IUPAC name of (7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one (CID 118715874) is (7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one.
What is the SMILES notation for (7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one?
The canonical SMILES for (7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one is O=C(Cc1ccc(-c2ccccc2)cc1)[C@@H]1Cc2cncn2C(=O)N1.
What is the InChIKey of (7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one?
The InChIKey is YVUPHUSLEFTSKX-SFHVURJKSA-N. The full InChI is InChI=1S/C20H17N3O2/c24-19(18-11-17-12-21-13-23(17)20(25)22-18)10-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h1-9,12-13,18H,10-11H2,(H,22,25)/t18-/m0/s1.
What are the key properties of (7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one?
(7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one has a molecular weight of 331.38 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-7-[2-(4-phenylphenyl)acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one is sourced from PubChem (CID 118715874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).