C27H27N3O2 — CID 118715875
(7S)-7-[2-[4-[2-(4-pentylphenyl)ethynyl]phenyl]acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one (PubChem CID 118715875) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is (7S)-7-[2-[4-[2-(4-pentylphenyl)ethynyl]phenyl]acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one.
| Compound Name | (7S)-7-[2-[4-[2-(4-pentylphenyl)ethynyl]phenyl]acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one |
|---|---|
| PubChem CID | 118715875 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (7S)-7-[2-[4-[2-(4-pentylphenyl)ethynyl]phenyl]acetyl]-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one |
| SMILES | CCCCCc1ccc(C#Cc2ccc(CC(=O)[C@@H]3Cc4cncn4C(=O)N3)cc2)cc1 |
| InChI | InChI=1S/C27H27N3O2/c1-2-3-4-5-20-6-8-21(9-7-20)10-11-22-12-14-23(15-13-22)16-26(31)25-17-24-18-28-19-30(24)27(32)29-25/h6-9,12-15,18-19,25H,2-5,16-17H2,1H3,(H,29,32)/t25-/m0/s1 |
| InChIKey | IGAPGBIRDJDHRP-VWLOTQADSA-N |
| XLogP | 4.31 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|