C14H12BrN3OS — CID 118715877
2-(4-bromophenyl)-1-[(7S)-5-sulfanylidene-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-7-yl]ethanone (PubChem CID 118715877) has the molecular formula C14H12BrN3OS and a molecular weight of 350.24 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-[(7S)-5-sulfanylidene-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-7-yl]ethanone.
| Compound Name | 2-(4-bromophenyl)-1-[(7S)-5-sulfanylidene-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-7-yl]ethanone |
|---|---|
| PubChem CID | 118715877 |
| Molecular Formula | C14H12BrN3OS |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 2-(4-bromophenyl)-1-[(7S)-5-sulfanylidene-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-7-yl]ethanone |
| SMILES | O=C(Cc1ccc(Br)cc1)[C@@H]1Cc2cncn2C(=S)N1 |
| InChI | InChI=1S/C14H12BrN3OS/c15-10-3-1-9(2-4-10)5-13(19)12-6-11-7-16-8-18(11)14(20)17-12/h1-4,7-8,12H,5-6H2,(H,17,20)/t12-/m0/s1 |
| InChIKey | DRLFXBNFHAENSJ-LBPRGKRZSA-N |
| XLogP | 2.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|