C21H25N2O6P — CID 118716139
[2-amino-2-(hydroxymethyl)-4-[4-[2-(4-methylphenyl)-1,3-oxazol-4-yl]phenyl]butyl] dihydrogen phosphate (PubChem CID 118716139) has the molecular formula C21H25N2O6P and a molecular weight of 432.41 g/mol. Its IUPAC name is [2-amino-2-(hydroxymethyl)-4-[4-[2-(4-methylphenyl)-1,3-oxazol-4-yl]phenyl]butyl] dihydrogen phosphate.
| Compound Name | [2-amino-2-(hydroxymethyl)-4-[4-[2-(4-methylphenyl)-1,3-oxazol-4-yl]phenyl]butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118716139 |
| Molecular Formula | C21H25N2O6P |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [2-amino-2-(hydroxymethyl)-4-[4-[2-(4-methylphenyl)-1,3-oxazol-4-yl]phenyl]butyl] dihydrogen phosphate |
| SMILES | Cc1ccc(-c2nc(-c3ccc(CCC(N)(CO)COP(=O)(O)O)cc3)co2)cc1 |
| InChI | InChI=1S/C21H25N2O6P/c1-15-2-6-18(7-3-15)20-23-19(12-28-20)17-8-4-16(5-9-17)10-11-21(22,13-24)14-29-30(25,26)27/h2-9,12,24H,10-11,13-14,22H2,1H3,(H2,25,26,27) |
| InChIKey | RDRIWSVUADCOIA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|