C21H25N2O7P — CID 118716140
[2-amino-2-(hydroxymethyl)-4-[4-[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]phenyl]butyl] dihydrogen phosphate (PubChem CID 118716140) has the molecular formula C21H25N2O7P and a molecular weight of 448.41 g/mol. Its IUPAC name is [2-amino-2-(hydroxymethyl)-4-[4-[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]phenyl]butyl] dihydrogen phosphate.
| Compound Name | [2-amino-2-(hydroxymethyl)-4-[4-[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]phenyl]butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118716140 |
| Molecular Formula | C21H25N2O7P |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | [2-amino-2-(hydroxymethyl)-4-[4-[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]phenyl]butyl] dihydrogen phosphate |
| SMILES | COc1ccc(-c2nc(-c3ccc(CCC(N)(CO)COP(=O)(O)O)cc3)co2)cc1 |
| InChI | InChI=1S/C21H25N2O7P/c1-28-18-8-6-17(7-9-18)20-23-19(12-29-20)16-4-2-15(3-5-16)10-11-21(22,13-24)14-30-31(25,26)27/h2-9,12,24H,10-11,13-14,22H2,1H3,(H2,25,26,27) |
| InChIKey | KDCAOJUCTNZIPQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 148.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|