C22H27N2O6P — CID 118716145
[2-amino-4-[4-[2-(4-ethylphenyl)-1,3-oxazol-4-yl]phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate (PubChem CID 118716145) has the molecular formula C22H27N2O6P and a molecular weight of 446.44 g/mol. Its IUPAC name is [2-amino-4-[4-[2-(4-ethylphenyl)-1,3-oxazol-4-yl]phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate.
| Compound Name | [2-amino-4-[4-[2-(4-ethylphenyl)-1,3-oxazol-4-yl]phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118716145 |
| Molecular Formula | C22H27N2O6P |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | [2-amino-4-[4-[2-(4-ethylphenyl)-1,3-oxazol-4-yl]phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate |
| SMILES | CCc1ccc(-c2nc(-c3ccc(CCC(N)(CO)COP(=O)(O)O)cc3)co2)cc1 |
| InChI | InChI=1S/C22H27N2O6P/c1-2-16-3-9-19(10-4-16)21-24-20(13-29-21)18-7-5-17(6-8-18)11-12-22(23,14-25)15-30-31(26,27)28/h3-10,13,25H,2,11-12,14-15,23H2,1H3,(H2,26,27,28) |
| InChIKey | CMHIRZWYQCZMIJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|